About methyl N-(2,6-dimethylphenyl)-2-(ethylamino)ethanimidate
methyl N-(2,6-dimethylphenyl)-2-(ethylamino)ethanimidate (PubChem CID 135213463) has the molecular formula C13H20N2O
and a molecular weight of 220.32 g/mol. Its IUPAC name is methyl N-(2,6-dimethylphenyl)-2-(ethylamino)ethanimidate.
Molecular Properties
| Compound Name | methyl N-(2,6-dimethylphenyl)-2-(ethylamino)ethanimidate |
| PubChem CID | 135213463 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | methyl N-(2,6-dimethylphenyl)-2-(ethylamino)ethanimidate |
| SMILES | CCNC/C(=N/c1c(C)cccc1C)OC |
| InChI | InChI=1S/C13H20N2O/c1-5-14-9-12(16-4)15-13-10(2)7-6-8-11(13)3/h6-8,14H,5,9H2,1-4H3/b15-12- |
| InChIKey | RILLRLRSVBHEJW-QINSGFPZSA-N |
| XLogP | 2.59 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N-(2,6-dimethylphenyl)-2-(ethylamino)ethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(2,6-dimethylphenyl)-2-(ethylamino)ethanimidate?
The IUPAC name of methyl N-(2,6-dimethylphenyl)-2-(ethylamino)ethanimidate (CID 135213463) is methyl N-(2,6-dimethylphenyl)-2-(ethylamino)ethanimidate.
What is the SMILES notation for methyl N-(2,6-dimethylphenyl)-2-(ethylamino)ethanimidate?
The canonical SMILES for methyl N-(2,6-dimethylphenyl)-2-(ethylamino)ethanimidate is CCNC/C(=N/c1c(C)cccc1C)OC.
What is the InChIKey of methyl N-(2,6-dimethylphenyl)-2-(ethylamino)ethanimidate?
The InChIKey is RILLRLRSVBHEJW-QINSGFPZSA-N. The full InChI is InChI=1S/C13H20N2O/c1-5-14-9-12(16-4)15-13-10(2)7-6-8-11(13)3/h6-8,14H,5,9H2,1-4H3/b15-12-.
What are the key properties of methyl N-(2,6-dimethylphenyl)-2-(ethylamino)ethanimidate?
methyl N-(2,6-dimethylphenyl)-2-(ethylamino)ethanimidate has a molecular weight of 220.32 g/mol, XLogP of 2.59, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(2,6-dimethylphenyl)-2-(ethylamino)ethanimidate is sourced from PubChem (CID 135213463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).