C43H60N4O3 — CID 122368305
decyl 3-[(2S,3S)-13-ethyl-8-(1-hydroxyethyl)-3,5,7,12,17,20-hexamethyl-2,3,23,24-tetrahydroporphyrin-2-yl]propanoate (PubChem CID 122368305) has the molecular formula C43H60N4O3 and a molecular weight of 680.98 g/mol. Its IUPAC name is decyl 3-[(2S,3S)-13-ethyl-8-(1-hydroxyethyl)-3,5,7,12,17,20-hexamethyl-2,3,23,24-tetrahydroporphyrin-2-yl]propanoate.
| Compound Name | decyl 3-[(2S,3S)-13-ethyl-8-(1-hydroxyethyl)-3,5,7,12,17,20-hexamethyl-2,3,23,24-tetrahydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 122368305 |
| Molecular Formula | C43H60N4O3 |
| Molecular Weight | 680.98 g/mol |
| Exact Mass | 680.47 |
| IUPAC Name | decyl 3-[(2S,3S)-13-ethyl-8-(1-hydroxyethyl)-3,5,7,12,17,20-hexamethyl-2,3,23,24-tetrahydroporphyrin-2-yl]propanoate |
| SMILES | CCCCCCCCCCOC(=O)CC[C@@H]1c2nc(c(C)c3nc(cc4[nH]c(cc5[nH]c(cc5C)c2C)c(CC)c4C)C(C(C)O)=C3C)[C@H]1C |
| InChI | InChI=1S/C43H60N4O3/c1-10-12-13-14-15-16-17-18-21-50-39(49)20-19-33-27(5)41-30(8)42-29(7)40(31(9)48)38(46-42)24-36-26(4)32(11-2)37(45-36)23-34-25(3)22-35(44-34)28(6)43(33)47-41/h22-24,27,31,33,44-45,48H,10-21H2,1-9H3/b34-23-,35-28-,36-24-,37-23-,38-24-,41-30-,42-30-,43-28-/t27-,31?,33-/m0/s1 |
| InChIKey | OZICEBQKJXXHMM-FQTMPYDHSA-N |
| XLogP | 10.77 |
| TPSA | 103.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.98 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|