C38H48N4O5 — CID 170274686
(17S,18S)-18-(2-carboxyethyl)-7-ethyl-3,8,13,17,20-pentamethyl-12-(2-pentoxyethyl)-17,18,21,22-tetrahydroporphyrin-2-carboxylic acid (PubChem CID 170274686) has the molecular formula C38H48N4O5 and a molecular weight of 640.82 g/mol. Its IUPAC name is (17S,18S)-18-(2-carboxyethyl)-7-ethyl-3,8,13,17,20-pentamethyl-12-(2-pentoxyethyl)-17,18,21,22-tetrahydroporphyrin-2-carboxylic acid.
| Compound Name | (17S,18S)-18-(2-carboxyethyl)-7-ethyl-3,8,13,17,20-pentamethyl-12-(2-pentoxyethyl)-17,18,21,22-tetrahydroporphyrin-2-carboxylic acid |
|---|---|
| PubChem CID | 170274686 |
| Molecular Formula | C38H48N4O5 |
| Molecular Weight | 640.82 g/mol |
| Exact Mass | 640.36 |
| IUPAC Name | (17S,18S)-18-(2-carboxyethyl)-7-ethyl-3,8,13,17,20-pentamethyl-12-(2-pentoxyethyl)-17,18,21,22-tetrahydroporphyrin-2-carboxylic acid |
| SMILES | CCCCCOCCC1=C(C)c2cc3nc(c(C)c4[nH]c(cc5[nH]c(cc1n2)c(C)c5CC)c(C)c4C(=O)O)[C@@H](CCC(=O)O)[C@@H]3C |
| InChI | InChI=1S/C38H48N4O5/c1-8-10-11-15-47-16-14-26-21(4)28-17-30-22(5)27(12-13-34(43)44)36(41-30)24(7)37-35(38(45)46)23(6)31(42-37)19-32-25(9-2)20(3)29(39-32)18-33(26)40-28/h17-19,22,27,39,42H,8-16H2,1-7H3,(H,43,44)(H,45,46)/b28-17-,29-18-,30-17-,31-19-,32-19-,33-18-,36-24-,37-24-/t22-,27-/m0/s1 |
| InChIKey | YIJMOGSUIPDKSS-PWQCCWMQSA-N |
| XLogP | 8.78 |
| TPSA | 141.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.82 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|