C36H41N5O6 — CID 174262470
(17S)-20-(carboxymethyl)-18-[3-(dimethylaminooxy)-3-oxopropyl]-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-17,18,21,22-tetrahydroporphyrin-2-carboxylic acid (PubChem CID 174262470) has the molecular formula C36H41N5O6 and a molecular weight of 639.75 g/mol. Its IUPAC name is (17S)-20-(carboxymethyl)-18-[3-(dimethylaminooxy)-3-oxopropyl]-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-17,18,21,22-tetrahydroporphyrin-2-carboxylic acid.
| Compound Name | (17S)-20-(carboxymethyl)-18-[3-(dimethylaminooxy)-3-oxopropyl]-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-17,18,21,22-tetrahydroporphyrin-2-carboxylic acid |
|---|---|
| PubChem CID | 174262470 |
| Molecular Formula | C36H41N5O6 |
| Molecular Weight | 639.75 g/mol |
| Exact Mass | 639.31 |
| IUPAC Name | (17S)-20-(carboxymethyl)-18-[3-(dimethylaminooxy)-3-oxopropyl]-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-17,18,21,22-tetrahydroporphyrin-2-carboxylic acid |
| SMILES | C=CC1=C(C)c2cc3nc(c(CC(=O)O)c4[nH]c(cc5[nH]c(cc1n2)c(C)c5CC)c(C)c4C(=O)O)C(CCC(=O)ON(C)C)[C@@H]3C |
| InChI | InChI=1S/C36H41N5O6/c1-9-21-17(3)25-14-27-19(5)23(11-12-32(44)47-41(7)8)34(39-27)24(13-31(42)43)35-33(36(45)46)20(6)28(40-35)16-30-22(10-2)18(4)26(38-30)15-29(21)37-25/h9,14-16,19,23,38,40H,1,10-13H2,2-8H3,(H,42,43)(H,45,46)/b25-14-,26-15-,27-14-,28-16-,29-15-,30-16-,34-24-,35-24-/t19-,23?/m0/s1 |
| InChIKey | AGUVMIGRIFBMNC-QTPAJMLLSA-N |
| XLogP | 6.62 |
| TPSA | 161.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.75 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|