C39H46N6O7 — CID 173486881
(2S,3S)-7-[(5-amino-1-carboxypentyl)carbamoyl]-3-(2-carboxyethyl)-17-ethenyl-12-ethyl-2,8,13,18-tetramethyl-2,3,22,23-tetrahydroporphyrin-5-carboxylic acid (PubChem CID 173486881) has the molecular formula C39H46N6O7 and a molecular weight of 710.83 g/mol. Its IUPAC name is (2S,3S)-7-[(5-amino-1-carboxypentyl)carbamoyl]-3-(2-carboxyethyl)-17-ethenyl-12-ethyl-2,8,13,18-tetramethyl-2,3,22,23-tetrahydroporphyrin-5-carboxylic acid.
| Compound Name | (2S,3S)-7-[(5-amino-1-carboxypentyl)carbamoyl]-3-(2-carboxyethyl)-17-ethenyl-12-ethyl-2,8,13,18-tetramethyl-2,3,22,23-tetrahydroporphyrin-5-carboxylic acid |
|---|---|
| PubChem CID | 173486881 |
| Molecular Formula | C39H46N6O7 |
| Molecular Weight | 710.83 g/mol |
| Exact Mass | 710.34 |
| IUPAC Name | (2S,3S)-7-[(5-amino-1-carboxypentyl)carbamoyl]-3-(2-carboxyethyl)-17-ethenyl-12-ethyl-2,8,13,18-tetramethyl-2,3,22,23-tetrahydroporphyrin-5-carboxylic acid |
| SMILES | C=CC1=C(C)c2cc3nc(c(C(=O)O)c4[nH]c(cc5[nH]c(cc1n2)c(C)c5CC)c(C)c4C(=O)NC(CCCCN)C(=O)O)[C@@H](CCC(=O)O)[C@@H]3C |
| InChI | InChI=1S/C39H46N6O7/c1-7-22-18(3)26-15-28-20(5)24(12-13-32(46)47)35(43-28)34(39(51)52)36-33(37(48)45-25(38(49)50)11-9-10-14-40)21(6)29(44-36)17-31-23(8-2)19(4)27(42-31)16-30(22)41-26/h7,15-17,20,24-25,42,44H,1,8-14,40H2,2-6H3,(H,45,48)(H,46,47)(H,49,50)(H,51,52)/b26-15-,27-16-,28-15-,29-17-,30-16-,31-17-,35-34+,36-34+/t20-,24-,25?/m0/s1 |
| InChIKey | TUULDJYNHACWTO-QLEOGJQGSA-N |
| XLogP | 6.37 |
| TPSA | 224.38 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.83 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|