C39H51N5O4 — CID 164944987
(17S,18S)-18-(2-carboxyethyl)-7-ethyl-12-[(heptylamino)methyl]-3,8,13,17,20-pentamethyl-17,18,21,22-tetrahydroporphyrin-2-carboxylic acid (PubChem CID 164944987) has the molecular formula C39H51N5O4 and a molecular weight of 653.87 g/mol. Its IUPAC name is (17S,18S)-18-(2-carboxyethyl)-7-ethyl-12-[(heptylamino)methyl]-3,8,13,17,20-pentamethyl-17,18,21,22-tetrahydroporphyrin-2-carboxylic acid.
| Compound Name | (17S,18S)-18-(2-carboxyethyl)-7-ethyl-12-[(heptylamino)methyl]-3,8,13,17,20-pentamethyl-17,18,21,22-tetrahydroporphyrin-2-carboxylic acid |
|---|---|
| PubChem CID | 164944987 |
| Molecular Formula | C39H51N5O4 |
| Molecular Weight | 653.87 g/mol |
| Exact Mass | 653.39 |
| IUPAC Name | (17S,18S)-18-(2-carboxyethyl)-7-ethyl-12-[(heptylamino)methyl]-3,8,13,17,20-pentamethyl-17,18,21,22-tetrahydroporphyrin-2-carboxylic acid |
| SMILES | CCCCCCCNCC1=C(C)c2cc3nc(c(C)c4[nH]c(cc5[nH]c(cc1n2)c(C)c5CC)c(C)c4C(=O)O)[C@@H](CCC(=O)O)[C@@H]3C |
| InChI | InChI=1S/C39H51N5O4/c1-8-10-11-12-13-16-40-20-28-23(5)29-17-31-22(4)27(14-15-35(45)46)37(43-31)25(7)38-36(39(47)48)24(6)32(44-38)19-33-26(9-2)21(3)30(41-33)18-34(28)42-29/h17-19,22,27,40-41,44H,8-16,20H2,1-7H3,(H,45,46)(H,47,48)/b29-17-,30-18-,31-17-,32-19-,33-19-,34-18-,37-25-,38-25-/t22-,27-/m0/s1 |
| InChIKey | YNEDBPLHADZEDX-QGJDRDGTSA-N |
| XLogP | 8.74 |
| TPSA | 143.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.87 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|