C33H34N4O6 — CID 173489650
(17S)-18,20-bis(carboxymethyl)-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-17,18,21,22-tetrahydroporphyrin-2-carboxylic acid (PubChem CID 173489650) has the molecular formula C33H34N4O6 and a molecular weight of 582.66 g/mol. Its IUPAC name is (17S)-18,20-bis(carboxymethyl)-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-17,18,21,22-tetrahydroporphyrin-2-carboxylic acid.
| Compound Name | (17S)-18,20-bis(carboxymethyl)-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-17,18,21,22-tetrahydroporphyrin-2-carboxylic acid |
|---|---|
| PubChem CID | 173489650 |
| Molecular Formula | C33H34N4O6 |
| Molecular Weight | 582.66 g/mol |
| Exact Mass | 582.25 |
| IUPAC Name | (17S)-18,20-bis(carboxymethyl)-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-17,18,21,22-tetrahydroporphyrin-2-carboxylic acid |
| SMILES | C=CC1=C(C)c2cc3nc(c(CC(=O)O)c4[nH]c(cc5[nH]c(cc1n2)c(C)c5CC)c(C)c4C(=O)O)C(CC(=O)O)[C@@H]3C |
| InChI | InChI=1S/C33H34N4O6/c1-7-18-14(3)22-11-24-16(5)20(9-28(38)39)31(36-24)21(10-29(40)41)32-30(33(42)43)17(6)25(37-32)13-27-19(8-2)15(4)23(35-27)12-26(18)34-22/h7,11-13,16,20,35,37H,1,8-10H2,2-6H3,(H,38,39)(H,40,41)(H,42,43)/b22-11-,23-12-,24-11-,25-13-,26-12-,27-13-,31-21-,32-21-/t16-,20?/m0/s1 |
| InChIKey | OTIUCNAAYDJUEL-POUHTBSCSA-N |
| XLogP | 6.30 |
| TPSA | 169.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.66 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |