C33H40N4O3 — CID 174068050
ethyl 3-[(2S,3S)-13-ethyl-8-(hydroxymethyl)-3,7,12,17,20-pentamethyl-2,3,23,24-tetrahydroporphyrin-2-yl]propanoate (PubChem CID 174068050) has the molecular formula C33H40N4O3 and a molecular weight of 540.71 g/mol. Its IUPAC name is ethyl 3-[(2S,3S)-13-ethyl-8-(hydroxymethyl)-3,7,12,17,20-pentamethyl-2,3,23,24-tetrahydroporphyrin-2-yl]propanoate.
| Compound Name | ethyl 3-[(2S,3S)-13-ethyl-8-(hydroxymethyl)-3,7,12,17,20-pentamethyl-2,3,23,24-tetrahydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 174068050 |
| Molecular Formula | C33H40N4O3 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | ethyl 3-[(2S,3S)-13-ethyl-8-(hydroxymethyl)-3,7,12,17,20-pentamethyl-2,3,23,24-tetrahydroporphyrin-2-yl]propanoate |
| SMILES | CCOC(=O)CC[C@@H]1c2nc(cc3nc(cc4[nH]c(cc5[nH]c(cc5C)c2C)c(CC)c4C)C(CO)=C3C)[C@H]1C |
| InChI | InChI=1S/C33H40N4O3/c1-8-22-18(4)28-15-31-24(16-38)20(6)27(36-31)14-29-19(5)23(10-11-32(39)40-9-2)33(37-29)21(7)26-12-17(3)25(34-26)13-30(22)35-28/h12-15,19,23,34-35,38H,8-11,16H2,1-7H3/b25-13-,26-21-,27-14-,28-15-,29-14-,30-13-,31-15-,33-21-/t19-,23-/m0/s1 |
| InChIKey | GFZPUMTXJTYHSH-RNUADFCMSA-N |
| XLogP | 6.96 |
| TPSA | 103.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |