C20H38O7Si — CID 122369685
[(3aS,4S,6R,6aR)-4-(methoxymethoxymethyl)-2,2-dimethyl-6-prop-2-enoxy-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 122369685) has the molecular formula C20H38O7Si and a molecular weight of 418.60 g/mol. Its IUPAC name is [(3aS,4S,6R,6aR)-4-(methoxymethoxymethyl)-2,2-dimethyl-6-prop-2-enoxy-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aS,4S,6R,6aR)-4-(methoxymethoxymethyl)-2,2-dimethyl-6-prop-2-enoxy-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 122369685 |
| Molecular Formula | C20H38O7Si |
| Molecular Weight | 418.60 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | [(3aS,4S,6R,6aR)-4-(methoxymethoxymethyl)-2,2-dimethyl-6-prop-2-enoxy-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C=CCO[C@@H]1O[C@@](COCOC)(CO[Si](C)(C)C(C)(C)C)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C20H38O7Si/c1-10-11-23-17-15-16(26-19(5,6)25-15)20(27-17,12-22-14-21-7)13-24-28(8,9)18(2,3)4/h10,15-17H,1,11-14H2,2-9H3/t15-,16+,17-,20+/m1/s1 |
| InChIKey | FGZCBNOAYSUPOU-YZLZLFLDSA-N |
| XLogP | 3.45 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.60 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|