C34H42N3O2Se2+ — CID 122370509
2-[(3-hexyl-3H-1,3-benzoselenazol-3-ium-2-ylidene)methyl]-4-[(3-hexyl-1,3-benzoselenazol-3-ium-2-yl)methylidene]-3-(2-hydroxyethylimino)cyclobuten-1-olate (PubChem CID 122370509) has the molecular formula C34H42N3O2Se2+ and a molecular weight of 682.65 g/mol. Its IUPAC name is 2-[(3-hexyl-3H-1,3-benzoselenazol-3-ium-2-ylidene)methyl]-4-[(3-hexyl-1,3-benzoselenazol-3-ium-2-yl)methylidene]-3-(2-hydroxyethylimino)cyclobuten-1-olate.
| Compound Name | 2-[(3-hexyl-3H-1,3-benzoselenazol-3-ium-2-ylidene)methyl]-4-[(3-hexyl-1,3-benzoselenazol-3-ium-2-yl)methylidene]-3-(2-hydroxyethylimino)cyclobuten-1-olate |
|---|---|
| PubChem CID | 122370509 |
| Molecular Formula | C34H42N3O2Se2+ |
| Molecular Weight | 682.65 g/mol |
| Exact Mass | 684.16 |
| IUPAC Name | 2-[(3-hexyl-3H-1,3-benzoselenazol-3-ium-2-ylidene)methyl]-4-[(3-hexyl-1,3-benzoselenazol-3-ium-2-yl)methylidene]-3-(2-hydroxyethylimino)cyclobuten-1-olate |
| SMILES | CCCCCC[n+]1c(C=C2C([O-])=C(C=C3[Se]c4ccccc4[NH+]3CCCCCC)/C2=N/CCO)[se]c2ccccc21 |
| InChI | InChI=1S/C34H41N3O2Se2/c1-3-5-7-13-20-36-27-15-9-11-17-29(27)40-31(36)23-25-33(35-19-22-38)26(34(25)39)24-32-37(21-14-8-6-4-2)28-16-10-12-18-30(28)41-32/h9-12,15-18,23-24,38H,3-8,13-14,19-22H2,1-2H3/p+1 |
| InChIKey | GKBJBRKGGOWYQQ-UHFFFAOYSA-O |
| XLogP | 3.19 |
| TPSA | 63.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.65 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|