C19H17F3N2O2 — CID 122372496
ethyl (2S)-2-amino-2-(benzo[f]quinolin-3-ylmethyl)-3,3,3-trifluoropropanoate (PubChem CID 122372496) has the molecular formula C19H17F3N2O2 and a molecular weight of 362.35 g/mol. Its IUPAC name is ethyl (2S)-2-amino-2-(benzo[f]quinolin-3-ylmethyl)-3,3,3-trifluoropropanoate.
| Compound Name | ethyl (2S)-2-amino-2-(benzo[f]quinolin-3-ylmethyl)-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 122372496 |
| Molecular Formula | C19H17F3N2O2 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | ethyl (2S)-2-amino-2-(benzo[f]quinolin-3-ylmethyl)-3,3,3-trifluoropropanoate |
| SMILES | CCOC(=O)[C@@](N)(Cc1ccc2c(ccc3ccccc32)n1)C(F)(F)F |
| InChI | InChI=1S/C19H17F3N2O2/c1-2-26-17(25)18(23,19(20,21)22)11-13-8-9-15-14-6-4-3-5-12(14)7-10-16(15)24-13/h3-10H,2,11,23H2,1H3/t18-/m0/s1 |
| InChIKey | AYTOKGSLOJUQNT-SFHVURJKSA-N |
| XLogP | 3.75 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|