C24H18N2O — CID 122385628
(3S,4S)-2-oxo-1,4,6-triphenyl-3,4-dihydropyridine-3-carbonitrile (PubChem CID 122385628) has the molecular formula C24H18N2O and a molecular weight of 350.42 g/mol. Its IUPAC name is (3S,4S)-2-oxo-1,4,6-triphenyl-3,4-dihydropyridine-3-carbonitrile.
| Compound Name | (3S,4S)-2-oxo-1,4,6-triphenyl-3,4-dihydropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 122385628 |
| Molecular Formula | C24H18N2O |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | (3S,4S)-2-oxo-1,4,6-triphenyl-3,4-dihydropyridine-3-carbonitrile |
| SMILES | N#C[C@H]1C(=O)N(c2ccccc2)C(c2ccccc2)=C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C24H18N2O/c25-17-22-21(18-10-4-1-5-11-18)16-23(19-12-6-2-7-13-19)26(24(22)27)20-14-8-3-9-15-20/h1-16,21-22H/t21-,22-/m1/s1 |
| InChIKey | BCUKHYNAOSUXBJ-FGZHOGPDSA-N |
| XLogP | 5.00 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |