C26H28N2O5 — CID 122386669
tert-butyl (1S,2R,6S,7R)-7-(4-methoxyphenyl)-3,5-dioxo-4-phenyl-4,10-diazatricyclo[5.2.1.02,6]decane-1-carboxylate (PubChem CID 122386669) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is tert-butyl (1S,2R,6S,7R)-7-(4-methoxyphenyl)-3,5-dioxo-4-phenyl-4,10-diazatricyclo[5.2.1.02,6]decane-1-carboxylate.
| Compound Name | tert-butyl (1S,2R,6S,7R)-7-(4-methoxyphenyl)-3,5-dioxo-4-phenyl-4,10-diazatricyclo[5.2.1.02,6]decane-1-carboxylate |
|---|---|
| PubChem CID | 122386669 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | tert-butyl (1S,2R,6S,7R)-7-(4-methoxyphenyl)-3,5-dioxo-4-phenyl-4,10-diazatricyclo[5.2.1.02,6]decane-1-carboxylate |
| SMILES | COc1ccc([C@]23CC[C@](C(=O)OC(C)(C)C)(N2)[C@@H]2C(=O)N(c4ccccc4)C(=O)[C@@H]23)cc1 |
| InChI | InChI=1S/C26H28N2O5/c1-24(2,3)33-23(31)26-15-14-25(27-26,16-10-12-18(32-4)13-11-16)19-20(26)22(30)28(21(19)29)17-8-6-5-7-9-17/h5-13,19-20,27H,14-15H2,1-4H3/t19-,20+,25+,26+/m1/s1 |
| InChIKey | LHEVKFUILUSQIH-RWVXUKFWSA-N |
| XLogP | 3.17 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|