C12H11NS — CID 122387474
1-thiophen-2-yl-6,7-dihydro-5H-cyclopenta[c]pyridine (PubChem CID 122387474) has the molecular formula C12H11NS and a molecular weight of 201.29 g/mol. Its IUPAC name is 1-thiophen-2-yl-6,7-dihydro-5H-cyclopenta[c]pyridine.
| Compound Name | 1-thiophen-2-yl-6,7-dihydro-5H-cyclopenta[c]pyridine |
|---|---|
| PubChem CID | 122387474 |
| Molecular Formula | C12H11NS |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 1-thiophen-2-yl-6,7-dihydro-5H-cyclopenta[c]pyridine |
| SMILES | c1csc(-c2nccc3c2CCC3)c1 |
| InChI | InChI=1S/C12H11NS/c1-3-9-6-7-13-12(10(9)4-1)11-5-2-8-14-11/h2,5-8H,1,3-4H2 |
| InChIKey | ICRWHEZSCYNCKX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |