C21H16FNO2 — CID 122387572
2-[4-(4-ethoxyphenyl)-2-fluorophenyl]-1,3-benzoxazole (PubChem CID 122387572) has the molecular formula C21H16FNO2 and a molecular weight of 333.36 g/mol. Its IUPAC name is 2-[4-(4-ethoxyphenyl)-2-fluorophenyl]-1,3-benzoxazole.
| Compound Name | 2-[4-(4-ethoxyphenyl)-2-fluorophenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 122387572 |
| Molecular Formula | C21H16FNO2 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 2-[4-(4-ethoxyphenyl)-2-fluorophenyl]-1,3-benzoxazole |
| SMILES | CCOc1ccc(-c2ccc(-c3nc4ccccc4o3)c(F)c2)cc1 |
| InChI | InChI=1S/C21H16FNO2/c1-2-24-16-10-7-14(8-11-16)15-9-12-17(18(22)13-15)21-23-19-5-3-4-6-20(19)25-21/h3-13H,2H2,1H3 |
| InChIKey | PNLVKGBUKIIOSJ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |