C27H27F2NO2 — CID 177420166
2-[2-fluoro-4-(2-fluoro-4-heptoxyphenyl)phenyl]-5-methyl-1,3-benzoxazole (PubChem CID 177420166) has the molecular formula C27H27F2NO2 and a molecular weight of 435.51 g/mol. Its IUPAC name is 2-[2-fluoro-4-(2-fluoro-4-heptoxyphenyl)phenyl]-5-methyl-1,3-benzoxazole.
| Compound Name | 2-[2-fluoro-4-(2-fluoro-4-heptoxyphenyl)phenyl]-5-methyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 177420166 |
| Molecular Formula | C27H27F2NO2 |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 2-[2-fluoro-4-(2-fluoro-4-heptoxyphenyl)phenyl]-5-methyl-1,3-benzoxazole |
| SMILES | CCCCCCCOc1ccc(-c2ccc(-c3nc4cc(C)ccc4o3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C27H27F2NO2/c1-3-4-5-6-7-14-31-20-10-12-21(24(29)17-20)19-9-11-22(23(28)16-19)27-30-25-15-18(2)8-13-26(25)32-27/h8-13,15-17H,3-7,14H2,1-2H3 |
| InChIKey | MUKBEUDHDRSOCK-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|