C24H21ClFNO2 — CID 122387575
5-chloro-2-[2-fluoro-4-(4-pentoxyphenyl)phenyl]-1,3-benzoxazole (PubChem CID 122387575) has the molecular formula C24H21ClFNO2 and a molecular weight of 409.89 g/mol. Its IUPAC name is 5-chloro-2-[2-fluoro-4-(4-pentoxyphenyl)phenyl]-1,3-benzoxazole.
| Compound Name | 5-chloro-2-[2-fluoro-4-(4-pentoxyphenyl)phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 122387575 |
| Molecular Formula | C24H21ClFNO2 |
| Molecular Weight | 409.89 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 5-chloro-2-[2-fluoro-4-(4-pentoxyphenyl)phenyl]-1,3-benzoxazole |
| SMILES | CCCCCOc1ccc(-c2ccc(-c3nc4cc(Cl)ccc4o3)c(F)c2)cc1 |
| InChI | InChI=1S/C24H21ClFNO2/c1-2-3-4-13-28-19-9-5-16(6-10-19)17-7-11-20(21(26)14-17)24-27-22-15-18(25)8-12-23(22)29-24/h5-12,14-15H,2-4,13H2,1H3 |
| InChIKey | KVKUEXZYRWYRQH-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.89 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|