C5H3N5O3 — CID 122387623
4-(2H-tetrazol-5-ylamino)cyclobutane-1,2,3-trione (PubChem CID 122387623) has the molecular formula C5H3N5O3 and a molecular weight of 181.11 g/mol. Its IUPAC name is 4-(2H-tetrazol-5-ylamino)cyclobutane-1,2,3-trione.
| Compound Name | 4-(2H-tetrazol-5-ylamino)cyclobutane-1,2,3-trione |
|---|---|
| PubChem CID | 122387623 |
| Molecular Formula | C5H3N5O3 |
| Molecular Weight | 181.11 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | 4-(2H-tetrazol-5-ylamino)cyclobutane-1,2,3-trione |
| SMILES | O=C1C(=O)C(Nc2nn[nH]n2)C1=O |
| InChI | InChI=1S/C5H3N5O3/c11-2-1(3(12)4(2)13)6-5-7-9-10-8-5/h1H,(H2,6,7,8,9,10) |
| InChIKey | NAVIELUJAOARPC-UHFFFAOYSA-N |
| XLogP | -2.30 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.11 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|