C20H12N4S2Se2 — CID 122388286
5,10-bis(4-methylthiophen-2-yl)-[2,1,3]benzoselenadiazolo[7,6-g][2,1,3]benzoselenadiazole (PubChem CID 122388286) has the molecular formula C20H12N4S2Se2 and a molecular weight of 530.40 g/mol. Its IUPAC name is 5,10-bis(4-methylthiophen-2-yl)-[2,1,3]benzoselenadiazolo[7,6-g][2,1,3]benzoselenadiazole.
| Compound Name | 5,10-bis(4-methylthiophen-2-yl)-[2,1,3]benzoselenadiazolo[7,6-g][2,1,3]benzoselenadiazole |
|---|---|
| PubChem CID | 122388286 |
| Molecular Formula | C20H12N4S2Se2 |
| Molecular Weight | 530.40 g/mol |
| Exact Mass | 531.88 |
| IUPAC Name | 5,10-bis(4-methylthiophen-2-yl)-[2,1,3]benzoselenadiazolo[7,6-g][2,1,3]benzoselenadiazole |
| SMILES | Cc1csc(-c2cc3c(cc(-c4cc(C)cs4)c4n[se]nc43)c3n[se]nc23)c1 |
| InChI | InChI=1S/C20H12N4S2Se2/c1-9-3-15(25-7-9)13-5-11-12(17-19(13)23-27-21-17)6-14(16-4-10(2)8-26-16)20-18(11)22-28-24-20/h3-8H,1-2H3 |
| InChIKey | VZUDBPJSLUAHCH-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.40 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|