C20H30N2O5 — CID 122391816
ditert-butyl (3S,6S,9R,12S)-2-oxo-1,4-diazatricyclo[7.3.0.03,6]dodec-7-ene-4,12-dicarboxylate (PubChem CID 122391816) has the molecular formula C20H30N2O5 and a molecular weight of 378.47 g/mol. Its IUPAC name is ditert-butyl (3S,6S,9R,12S)-2-oxo-1,4-diazatricyclo[7.3.0.03,6]dodec-7-ene-4,12-dicarboxylate.
| Compound Name | ditert-butyl (3S,6S,9R,12S)-2-oxo-1,4-diazatricyclo[7.3.0.03,6]dodec-7-ene-4,12-dicarboxylate |
|---|---|
| PubChem CID | 122391816 |
| Molecular Formula | C20H30N2O5 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | ditert-butyl (3S,6S,9R,12S)-2-oxo-1,4-diazatricyclo[7.3.0.03,6]dodec-7-ene-4,12-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CC[C@@H]2C=C[C@H]3CN(C(=O)OC(C)(C)C)[C@@H]3C(=O)N21 |
| InChI | InChI=1S/C20H30N2O5/c1-19(2,3)26-17(24)14-10-9-13-8-7-12-11-21(15(12)16(23)22(13)14)18(25)27-20(4,5)6/h7-8,12-15H,9-11H2,1-6H3/t12-,13-,14-,15-/m0/s1 |
| InChIKey | ANEHBFANBDQJIO-AJNGGQMLSA-N |
| XLogP | 2.49 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|