C21H32N2O5 — CID 56849906
ditert-butyl (3S,7R,10R,13S)-2-oxo-1,4-diazatricyclo[8.3.0.03,7]tridec-8-ene-4,13-dicarboxylate (PubChem CID 56849906) has the molecular formula C21H32N2O5 and a molecular weight of 392.50 g/mol. Its IUPAC name is ditert-butyl (3S,7R,10R,13S)-2-oxo-1,4-diazatricyclo[8.3.0.03,7]tridec-8-ene-4,13-dicarboxylate.
| Compound Name | ditert-butyl (3S,7R,10R,13S)-2-oxo-1,4-diazatricyclo[8.3.0.03,7]tridec-8-ene-4,13-dicarboxylate |
|---|---|
| PubChem CID | 56849906 |
| Molecular Formula | C21H32N2O5 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | ditert-butyl (3S,7R,10R,13S)-2-oxo-1,4-diazatricyclo[8.3.0.03,7]tridec-8-ene-4,13-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CC[C@@H]2C=C[C@H]3CCN(C(=O)OC(C)(C)C)[C@@H]3C(=O)N21 |
| InChI | InChI=1S/C21H32N2O5/c1-20(2,3)27-18(25)15-10-9-14-8-7-13-11-12-22(16(13)17(24)23(14)15)19(26)28-21(4,5)6/h7-8,13-16H,9-12H2,1-6H3/t13-,14-,15-,16-/m0/s1 |
| InChIKey | GOIZONVXMXHPOC-VGWMRTNUSA-N |
| XLogP | 2.88 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|