C21H22N2O4 — CID 122391902
(NZ)-N-(3,4,5-trimethoxy-12-methyl-12-azatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),2,4,6,13,15,17-heptaen-10-ylidene)hydroxylamine (PubChem CID 122391902) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is (NZ)-N-(3,4,5-trimethoxy-12-methyl-12-azatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),2,4,6,13,15,17-heptaen-10-ylidene)hydroxylamine.
| Compound Name | (NZ)-N-(3,4,5-trimethoxy-12-methyl-12-azatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),2,4,6,13,15,17-heptaen-10-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 122391902 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | (NZ)-N-(3,4,5-trimethoxy-12-methyl-12-azatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),2,4,6,13,15,17-heptaen-10-ylidene)hydroxylamine |
| SMILES | COc1cc2c(c(OC)c1OC)-c1c(n(C)c3ccccc13)/C(=N\O)CC2 |
| InChI | InChI=1S/C21H22N2O4/c1-23-15-8-6-5-7-13(15)18-17-12(9-10-14(22-24)19(18)23)11-16(25-2)20(26-3)21(17)27-4/h5-8,11,24H,9-10H2,1-4H3/b22-14- |
| InChIKey | FLFLEIPKEHZKRX-HMAPJEAMSA-N |
| XLogP | 4.00 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|