C18H19N2P — CID 122397088
(3,5-dimethylpyrazol-1-yl)methyl-diphenylphosphane (PubChem CID 122397088) has the molecular formula C18H19N2P and a molecular weight of 294.34 g/mol. Its IUPAC name is (3,5-dimethylpyrazol-1-yl)methyl-diphenylphosphane.
| Compound Name | (3,5-dimethylpyrazol-1-yl)methyl-diphenylphosphane |
|---|---|
| PubChem CID | 122397088 |
| Molecular Formula | C18H19N2P |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (3,5-dimethylpyrazol-1-yl)methyl-diphenylphosphane |
| SMILES | Cc1cc(C)n(CP(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C18H19N2P/c1-15-13-16(2)20(19-15)14-21(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-13H,14H2,1-2H3 |
| InChIKey | HVRNYYJPFXTADC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|