C29H26O6 — CID 122399786
dimethyl 5-(4-methoxyphenyl)-1,2-diphenyl-4-oxaspiro[2.4]hept-1-ene-7,7-dicarboxylate (PubChem CID 122399786) has the molecular formula C29H26O6 and a molecular weight of 470.52 g/mol. Its IUPAC name is dimethyl 5-(4-methoxyphenyl)-1,2-diphenyl-4-oxaspiro[2.4]hept-1-ene-7,7-dicarboxylate.
| Compound Name | dimethyl 5-(4-methoxyphenyl)-1,2-diphenyl-4-oxaspiro[2.4]hept-1-ene-7,7-dicarboxylate |
|---|---|
| PubChem CID | 122399786 |
| Molecular Formula | C29H26O6 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | dimethyl 5-(4-methoxyphenyl)-1,2-diphenyl-4-oxaspiro[2.4]hept-1-ene-7,7-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(c2ccc(OC)cc2)OC12C(c1ccccc1)=C2c1ccccc1 |
| InChI | InChI=1S/C29H26O6/c1-32-22-16-14-19(15-17-22)23-18-28(26(30)33-2,27(31)34-3)29(35-23)24(20-10-6-4-7-11-20)25(29)21-12-8-5-9-13-21/h4-17,23H,18H2,1-3H3 |
| InChIKey | YOWPQTNPAPHHPB-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|