C21H26O3 — CID 122399857
2,3,3-trimethylbutan-2-yl 2-methyl-3-naphthalen-1-yloxirane-2-carboxylate (PubChem CID 122399857) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is 2,3,3-trimethylbutan-2-yl 2-methyl-3-naphthalen-1-yloxirane-2-carboxylate.
| Compound Name | 2,3,3-trimethylbutan-2-yl 2-methyl-3-naphthalen-1-yloxirane-2-carboxylate |
|---|---|
| PubChem CID | 122399857 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 2,3,3-trimethylbutan-2-yl 2-methyl-3-naphthalen-1-yloxirane-2-carboxylate |
| SMILES | CC1(C(=O)OC(C)(C)C(C)(C)C)OC1c1cccc2ccccc12 |
| InChI | InChI=1S/C21H26O3/c1-19(2,3)20(4,5)24-18(22)21(6)17(23-21)16-13-9-11-14-10-7-8-12-15(14)16/h7-13,17H,1-6H3 |
| InChIKey | SUBZYPPNWRRERT-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|