C17H14F4O3 — CID 46189613
[(2R,5R)-3,3,4,4-tetrafluoro-5-naphthalen-1-yloxolan-2-yl]methyl acetate (PubChem CID 46189613) has the molecular formula C17H14F4O3 and a molecular weight of 342.29 g/mol. Its IUPAC name is [(2R,5R)-3,3,4,4-tetrafluoro-5-naphthalen-1-yloxolan-2-yl]methyl acetate.
| Compound Name | [(2R,5R)-3,3,4,4-tetrafluoro-5-naphthalen-1-yloxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 46189613 |
| Molecular Formula | C17H14F4O3 |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | [(2R,5R)-3,3,4,4-tetrafluoro-5-naphthalen-1-yloxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](c2cccc3ccccc23)C(F)(F)C1(F)F |
| InChI | InChI=1S/C17H14F4O3/c1-10(22)23-9-14-16(18,19)17(20,21)15(24-14)13-8-4-6-11-5-2-3-7-12(11)13/h2-8,14-15H,9H2,1H3/t14-,15-/m1/s1 |
| InChIKey | RWFQSGHSMBAJGY-HUUCEWRRSA-N |
| XLogP | 4.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|