C33H24O4 — CID 139037161
[(2R,5R)-4-benzoyl-2-naphthalen-1-yl-5-phenyl-1,3-dioxolan-4-yl]-phenylmethanone (PubChem CID 139037161) has the molecular formula C33H24O4 and a molecular weight of 484.55 g/mol. Its IUPAC name is [(2R,5R)-4-benzoyl-2-naphthalen-1-yl-5-phenyl-1,3-dioxolan-4-yl]-phenylmethanone.
| Compound Name | [(2R,5R)-4-benzoyl-2-naphthalen-1-yl-5-phenyl-1,3-dioxolan-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 139037161 |
| Molecular Formula | C33H24O4 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | [(2R,5R)-4-benzoyl-2-naphthalen-1-yl-5-phenyl-1,3-dioxolan-4-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)C1(C(=O)c2ccccc2)O[C@H](c2cccc3ccccc23)O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C33H24O4/c34-29(24-14-4-1-5-15-24)33(30(35)25-16-6-2-7-17-25)31(26-18-8-3-9-19-26)36-32(37-33)28-22-12-20-23-13-10-11-21-27(23)28/h1-22,31-32H/t31-,32-/m1/s1 |
| InChIKey | WLSYXRPAYHYZAW-ROJLCIKYSA-N |
| XLogP | 7.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|