C18H30O3 — CID 122405987
(2S)-2-[(3aR,4R,6aR)-3a-methyl-1a,2,3,4,5,6,6a,6b-octahydroindeno[4,5-b]oxiren-4-yl]-4-(3,3-dimethyloxiran-2-yl)butan-1-ol (PubChem CID 122405987) has the molecular formula C18H30O3 and a molecular weight of 294.43 g/mol. Its IUPAC name is (2S)-2-[(3aR,4R,6aR)-3a-methyl-1a,2,3,4,5,6,6a,6b-octahydroindeno[4,5-b]oxiren-4-yl]-4-(3,3-dimethyloxiran-2-yl)butan-1-ol.
| Compound Name | (2S)-2-[(3aR,4R,6aR)-3a-methyl-1a,2,3,4,5,6,6a,6b-octahydroindeno[4,5-b]oxiren-4-yl]-4-(3,3-dimethyloxiran-2-yl)butan-1-ol |
|---|---|
| PubChem CID | 122405987 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.43 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (2S)-2-[(3aR,4R,6aR)-3a-methyl-1a,2,3,4,5,6,6a,6b-octahydroindeno[4,5-b]oxiren-4-yl]-4-(3,3-dimethyloxiran-2-yl)butan-1-ol |
| SMILES | CC1(C)OC1CC[C@H](CO)[C@H]1CC[C@H]2C3OC3CC[C@]12C |
| InChI | InChI=1S/C18H30O3/c1-17(2)15(21-17)7-4-11(10-19)12-5-6-13-16-14(20-16)8-9-18(12,13)3/h11-16,19H,4-10H2,1-3H3/t11-,12-,13+,14?,15?,16?,18-/m1/s1 |
| InChIKey | BJBDMJGJNNJDBH-MYDPPOEKSA-N |
| XLogP | 3.15 |
| TPSA | 45.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|