C20H35NO2S — CID 122410893
[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] (3S)-3-(2-sulfanylidenepyrrolidin-1-yl)hexanoate (PubChem CID 122410893) has the molecular formula C20H35NO2S and a molecular weight of 353.57 g/mol. Its IUPAC name is [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] (3S)-3-(2-sulfanylidenepyrrolidin-1-yl)hexanoate.
| Compound Name | [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] (3S)-3-(2-sulfanylidenepyrrolidin-1-yl)hexanoate |
|---|---|
| PubChem CID | 122410893 |
| Molecular Formula | C20H35NO2S |
| Molecular Weight | 353.57 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] (3S)-3-(2-sulfanylidenepyrrolidin-1-yl)hexanoate |
| SMILES | CCC[C@@H](CC(=O)O[C@H]1C[C@@H](C)CC[C@@H]1C(C)C)N1CCCC1=S |
| InChI | InChI=1S/C20H35NO2S/c1-5-7-16(21-11-6-8-19(21)24)13-20(22)23-18-12-15(4)9-10-17(18)14(2)3/h14-18H,5-13H2,1-4H3/t15-,16-,17+,18-/m0/s1 |
| InChIKey | SGWHYUCJWCZEDL-FJIDUMEYSA-N |
| XLogP | 4.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.57 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|