C20H19ClN4O6 — CID 122417695
N-(4-chloro-3-nitrophenyl)-5-(1-ethoxyethoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinazolin-10-amine (PubChem CID 122417695) has the molecular formula C20H19ClN4O6 and a molecular weight of 446.85 g/mol. Its IUPAC name is N-(4-chloro-3-nitrophenyl)-5-(1-ethoxyethoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinazolin-10-amine.
| Compound Name | N-(4-chloro-3-nitrophenyl)-5-(1-ethoxyethoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinazolin-10-amine |
|---|---|
| PubChem CID | 122417695 |
| Molecular Formula | C20H19ClN4O6 |
| Molecular Weight | 446.85 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | N-(4-chloro-3-nitrophenyl)-5-(1-ethoxyethoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinazolin-10-amine |
| SMILES | CCOC(C)Oc1cc2ncnc(Nc3ccc(Cl)c([N+](=O)[O-])c3)c2c2c1OCCO2 |
| InChI | InChI=1S/C20H19ClN4O6/c1-3-28-11(2)31-16-9-14-17(19-18(16)29-6-7-30-19)20(23-10-22-14)24-12-4-5-13(21)15(8-12)25(26)27/h4-5,8-11H,3,6-7H2,1-2H3,(H,22,23,24) |
| InChIKey | AGOVZOXQAPLQHF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.85 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|