C13H9ClN6O4S — CID 19709311
N-(4-chloro-3-nitrophenyl)-6-methylsulfonylpyrimido[5,4-d]pyrimidin-4-amine (PubChem CID 19709311) has the molecular formula C13H9ClN6O4S and a molecular weight of 380.77 g/mol. Its IUPAC name is N-(4-chloro-3-nitrophenyl)-6-methylsulfonylpyrimido[5,4-d]pyrimidin-4-amine.
| Compound Name | N-(4-chloro-3-nitrophenyl)-6-methylsulfonylpyrimido[5,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 19709311 |
| Molecular Formula | C13H9ClN6O4S |
| Molecular Weight | 380.77 g/mol |
| Exact Mass | 380.01 |
| IUPAC Name | N-(4-chloro-3-nitrophenyl)-6-methylsulfonylpyrimido[5,4-d]pyrimidin-4-amine |
| SMILES | CS(=O)(=O)c1ncc2ncnc(Nc3ccc(Cl)c([N+](=O)[O-])c3)c2n1 |
| InChI | InChI=1S/C13H9ClN6O4S/c1-25(23,24)13-15-5-9-11(19-13)12(17-6-16-9)18-7-2-3-8(14)10(4-7)20(21)22/h2-6H,1H3,(H,16,17,18) |
| InChIKey | BXWXZPAGAXIXEE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 140.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.77 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|