C13H11N7O4S — CID 19709102
4-N-(6-methylsulfonylpyrimido[5,4-d]pyrimidin-4-yl)-2-nitrobenzene-1,4-diamine (PubChem CID 19709102) has the molecular formula C13H11N7O4S and a molecular weight of 361.34 g/mol. Its IUPAC name is 4-N-(6-methylsulfonylpyrimido[5,4-d]pyrimidin-4-yl)-2-nitrobenzene-1,4-diamine.
| Compound Name | 4-N-(6-methylsulfonylpyrimido[5,4-d]pyrimidin-4-yl)-2-nitrobenzene-1,4-diamine |
|---|---|
| PubChem CID | 19709102 |
| Molecular Formula | C13H11N7O4S |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 4-N-(6-methylsulfonylpyrimido[5,4-d]pyrimidin-4-yl)-2-nitrobenzene-1,4-diamine |
| SMILES | CS(=O)(=O)c1ncc2ncnc(Nc3ccc(N)c([N+](=O)[O-])c3)c2n1 |
| InChI | InChI=1S/C13H11N7O4S/c1-25(23,24)13-15-5-9-11(19-13)12(17-6-16-9)18-7-2-3-8(14)10(4-7)20(21)22/h2-6H,14H2,1H3,(H,16,17,18) |
| InChIKey | HQPJLGMEJBHZJR-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 166.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|