C33H50ClN10O4+ — CID 122420280
2-[[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methyl]-N,1,3-triethyl-6-[2-[(1-hexylpiperidin-4-yl)amino]-2-oxoethoxy]benzimidazol-1-ium-5-carboxamide (PubChem CID 122420280) has the molecular formula C33H50ClN10O4+ and a molecular weight of 686.28 g/mol. Its IUPAC name is 2-[[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methyl]-N,1,3-triethyl-6-[2-[(1-hexylpiperidin-4-yl)amino]-2-oxoethoxy]benzimidazol-1-ium-5-carboxamide.
| Compound Name | 2-[[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methyl]-N,1,3-triethyl-6-[2-[(1-hexylpiperidin-4-yl)amino]-2-oxoethoxy]benzimidazol-1-ium-5-carboxamide |
|---|---|
| PubChem CID | 122420280 |
| Molecular Formula | C33H50ClN10O4+ |
| Molecular Weight | 686.28 g/mol |
| Exact Mass | 685.37 |
| IUPAC Name | 2-[[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methyl]-N,1,3-triethyl-6-[2-[(1-hexylpiperidin-4-yl)amino]-2-oxoethoxy]benzimidazol-1-ium-5-carboxamide |
| SMILES | CCCCCCN1CCC(NC(=O)COc2cc3c(cc2C(=O)NCC)n(CC)c(CNC(=O)c2nc(Cl)c(N)nc2N)[n+]3CC)CC1 |
| InChI | InChI=1S/C33H49ClN10O4/c1-5-9-10-11-14-42-15-12-21(13-16-42)39-26(45)20-48-25-18-24-23(17-22(25)32(46)37-6-2)43(7-3)27(44(24)8-4)19-38-33(47)28-30(35)41-31(36)29(34)40-28/h17-18,21H,5-16,19-20H2,1-4H3,(H6-,35,36,37,38,39,41,45,46,47)/p+1 |
| InChIKey | OJMIPEOKFFLWCH-UHFFFAOYSA-O |
| XLogP | 2.80 |
| TPSA | 186.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|