C7H6N4O2S — CID 122431991
7-nitro-2,3-dihydro-1H-1,2,3-benzotriazine-4-thione (PubChem CID 122431991) has the molecular formula C7H6N4O2S and a molecular weight of 210.22 g/mol. Its IUPAC name is 7-nitro-2,3-dihydro-1H-1,2,3-benzotriazine-4-thione.
| Compound Name | 7-nitro-2,3-dihydro-1H-1,2,3-benzotriazine-4-thione |
|---|---|
| PubChem CID | 122431991 |
| Molecular Formula | C7H6N4O2S |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | 7-nitro-2,3-dihydro-1H-1,2,3-benzotriazine-4-thione |
| SMILES | O=[N+]([O-])c1ccc2c(c1)NNNC2=S |
| InChI | InChI=1S/C7H6N4O2S/c12-11(13)4-1-2-5-6(3-4)8-10-9-7(5)14/h1-3,8,10H,(H,9,14) |
| InChIKey | QMYVTMXTTLWSGP-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|