About 2-[4-(3,4-dihydro-2H-quinolin-1-yl)phenyl]-5-fluorobenzene-1,3-dicarbonitrile
2-[4-(3,4-dihydro-2H-quinolin-1-yl)phenyl]-5-fluorobenzene-1,3-dicarbonitrile (PubChem CID 122435764) has the molecular formula C23H16FN3
and a molecular weight of 353.40 g/mol. Its IUPAC name is 2-[4-(3,4-dihydro-2H-quinolin-1-yl)phenyl]-5-fluorobenzene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | 2-[4-(3,4-dihydro-2H-quinolin-1-yl)phenyl]-5-fluorobenzene-1,3-dicarbonitrile |
| PubChem CID | 122435764 |
| Molecular Formula | C23H16FN3 |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 2-[4-(3,4-dihydro-2H-quinolin-1-yl)phenyl]-5-fluorobenzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(F)cc(C#N)c1-c1ccc(N2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C23H16FN3/c24-20-12-18(14-25)23(19(13-20)15-26)17-7-9-21(10-8-17)27-11-3-5-16-4-1-2-6-22(16)27/h1-2,4,6-10,12-13H,3,5,11H2 |
| InChIKey | LONSEQDMHODYBB-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-(3,4-dihydro-2H-quinolin-1-yl)phenyl]-5-fluorobenzene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3,4-dihydro-2H-quinolin-1-yl)phenyl]-5-fluorobenzene-1,3-dicarbonitrile?
The IUPAC name of 2-[4-(3,4-dihydro-2H-quinolin-1-yl)phenyl]-5-fluorobenzene-1,3-dicarbonitrile (CID 122435764) is 2-[4-(3,4-dihydro-2H-quinolin-1-yl)phenyl]-5-fluorobenzene-1,3-dicarbonitrile.
What is the SMILES notation for 2-[4-(3,4-dihydro-2H-quinolin-1-yl)phenyl]-5-fluorobenzene-1,3-dicarbonitrile?
The canonical SMILES for 2-[4-(3,4-dihydro-2H-quinolin-1-yl)phenyl]-5-fluorobenzene-1,3-dicarbonitrile is N#Cc1cc(F)cc(C#N)c1-c1ccc(N2CCCc3ccccc32)cc1.
What is the InChIKey of 2-[4-(3,4-dihydro-2H-quinolin-1-yl)phenyl]-5-fluorobenzene-1,3-dicarbonitrile?
The InChIKey is LONSEQDMHODYBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16FN3/c24-20-12-18(14-25)23(19(13-20)15-26)17-7-9-21(10-8-17)27-11-3-5-16-4-1-2-6-22(16)27/h1-2,4,6-10,12-13H,3,5,11H2.
What are the key properties of 2-[4-(3,4-dihydro-2H-quinolin-1-yl)phenyl]-5-fluorobenzene-1,3-dicarbonitrile?
2-[4-(3,4-dihydro-2H-quinolin-1-yl)phenyl]-5-fluorobenzene-1,3-dicarbonitrile has a molecular weight of 353.40 g/mol, XLogP of 5.32, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3,4-dihydro-2H-quinolin-1-yl)phenyl]-5-fluorobenzene-1,3-dicarbonitrile is sourced from PubChem (CID 122435764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).