C27H33ClFN5O4 — CID 122437261
tert-butyl formate;4-N-(3-chloro-4-fluorophenyl)-7-(oxolan-3-yloxy)-6-N-pyrrolidin-3-ylquinazoline-4,6-diamine (PubChem CID 122437261) has the molecular formula C27H33ClFN5O4 and a molecular weight of 546.04 g/mol. Its IUPAC name is tert-butyl formate;4-N-(3-chloro-4-fluorophenyl)-7-(oxolan-3-yloxy)-6-N-pyrrolidin-3-ylquinazoline-4,6-diamine.
| Compound Name | tert-butyl formate;4-N-(3-chloro-4-fluorophenyl)-7-(oxolan-3-yloxy)-6-N-pyrrolidin-3-ylquinazoline-4,6-diamine |
|---|---|
| PubChem CID | 122437261 |
| Molecular Formula | C27H33ClFN5O4 |
| Molecular Weight | 546.04 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | tert-butyl formate;4-N-(3-chloro-4-fluorophenyl)-7-(oxolan-3-yloxy)-6-N-pyrrolidin-3-ylquinazoline-4,6-diamine |
| SMILES | CC(C)(C)OC=O.Fc1ccc(Nc2ncnc3cc(OC4CCOC4)c(NC4CCNC4)cc23)cc1Cl |
| InChI | InChI=1S/C22H23ClFN5O2.C5H10O2/c23-17-7-13(1-2-18(17)24)29-22-16-8-20(28-14-3-5-25-10-14)21(9-19(16)26-12-27-22)31-15-4-6-30-11-15;1-5(2,3)7-4-6/h1-2,7-9,12,14-15,25,28H,3-6,10-11H2,(H,26,27,29);4H,1-3H3 |
| InChIKey | DOOQKWMIMGKVNR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 106.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.04 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|