C30H33N3O — CID 122442530
3-(2-aminoethyl)-1H-indol-5-ol;N,N-dimethyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)propan-1-amine (PubChem CID 122442530) has the molecular formula C30H33N3O and a molecular weight of 451.61 g/mol. Its IUPAC name is 3-(2-aminoethyl)-1H-indol-5-ol;N,N-dimethyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)propan-1-amine.
| Compound Name | 3-(2-aminoethyl)-1H-indol-5-ol;N,N-dimethyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)propan-1-amine |
|---|---|
| PubChem CID | 122442530 |
| Molecular Formula | C30H33N3O |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | 3-(2-aminoethyl)-1H-indol-5-ol;N,N-dimethyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)propan-1-amine |
| SMILES | CN(C)CCC=C1c2ccccc2C=Cc2ccccc21.NCCc1c[nH]c2ccc(O)cc12 |
| InChI | InChI=1S/C20H21N.C10H12N2O/c1-21(2)15-7-12-20-18-10-5-3-8-16(18)13-14-17-9-4-6-11-19(17)20;11-4-3-7-6-12-10-2-1-8(13)5-9(7)10/h3-6,8-14H,7,15H2,1-2H3;1-2,5-6,12-13H,3-4,11H2 |
| InChIKey | GRBAHBHJQXRWBM-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|