C29H26ClN6O4+ — CID 122447628
4-[[1-[(E)-3-[5-chloro-2-(2H-tetrazol-1-ium-1-yl)phenyl]prop-2-enoyl]-3-phenylpiperidine-2-carbonyl]amino]benzoic acid (PubChem CID 122447628) has the molecular formula C29H26ClN6O4+ and a molecular weight of 558.02 g/mol. Its IUPAC name is 4-[[1-[(E)-3-[5-chloro-2-(2H-tetrazol-1-ium-1-yl)phenyl]prop-2-enoyl]-3-phenylpiperidine-2-carbonyl]amino]benzoic acid.
| Compound Name | 4-[[1-[(E)-3-[5-chloro-2-(2H-tetrazol-1-ium-1-yl)phenyl]prop-2-enoyl]-3-phenylpiperidine-2-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 122447628 |
| Molecular Formula | C29H26ClN6O4+ |
| Molecular Weight | 558.02 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | 4-[[1-[(E)-3-[5-chloro-2-(2H-tetrazol-1-ium-1-yl)phenyl]prop-2-enoyl]-3-phenylpiperidine-2-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)C2C(c3ccccc3)CCCN2C(=O)/C=C/c2cc(Cl)ccc2-[n+]2cnn[nH]2)cc1 |
| InChI | InChI=1S/C29H25ClN6O4/c30-22-11-14-25(36-18-31-33-34-36)21(17-22)10-15-26(37)35-16-4-7-24(19-5-2-1-3-6-19)27(35)28(38)32-23-12-8-20(9-13-23)29(39)40/h1-3,5-6,8-15,17-18,24,27H,4,7,16H2,(H2,32,38,39,40)/p+1/b15-10+ |
| InChIKey | PMPKVAXGXIISDC-XNTDXEJSSA-O |
| XLogP | 3.86 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.02 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|