C38H42N2O11S — CID 122447763
prop-2-enyl (2S)-3-[(1R)-2-acetamido-1-[[(4S)-2-phenyl-4-[(2-sulfanylacetyl)oxymethyl]-1,3-dioxan-5-yl]oxy]ethoxy]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate (PubChem CID 122447763) has the molecular formula C38H42N2O11S and a molecular weight of 734.82 g/mol. Its IUPAC name is prop-2-enyl (2S)-3-[(1R)-2-acetamido-1-[[(4S)-2-phenyl-4-[(2-sulfanylacetyl)oxymethyl]-1,3-dioxan-5-yl]oxy]ethoxy]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate.
| Compound Name | prop-2-enyl (2S)-3-[(1R)-2-acetamido-1-[[(4S)-2-phenyl-4-[(2-sulfanylacetyl)oxymethyl]-1,3-dioxan-5-yl]oxy]ethoxy]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 122447763 |
| Molecular Formula | C38H42N2O11S |
| Molecular Weight | 734.82 g/mol |
| Exact Mass | 734.25 |
| IUPAC Name | prop-2-enyl (2S)-3-[(1R)-2-acetamido-1-[[(4S)-2-phenyl-4-[(2-sulfanylacetyl)oxymethyl]-1,3-dioxan-5-yl]oxy]ethoxy]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
| SMILES | C=CCOC(=O)[C@H](CO[C@@H](CNC(C)=O)OC1COC(c2ccccc2)O[C@H]1COC(=O)CS)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C38H42N2O11S/c1-3-17-45-36(43)31(40-38(44)49-19-30-28-15-9-7-13-26(28)27-14-8-10-16-29(27)30)20-47-35(18-39-24(2)41)50-32-22-48-37(25-11-5-4-6-12-25)51-33(32)21-46-34(42)23-52/h3-16,30-33,35,37,52H,1,17-23H2,2H3,(H,39,41)(H,40,44)/t31-,32?,33-,35+,37?/m0/s1 |
| InChIKey | JHAFJBNZSRIOMZ-XTALQHKMSA-N |
| XLogP | 4.07 |
| TPSA | 156.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.82 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|