C22H20F3N3O3 — CID 122455862
2-[[2-cyclopropyl-6-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrimidin-4-yl]methyl]isoindole-1,3-dione (PubChem CID 122455862) has the molecular formula C22H20F3N3O3 and a molecular weight of 431.41 g/mol. Its IUPAC name is 2-[[2-cyclopropyl-6-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrimidin-4-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[2-cyclopropyl-6-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrimidin-4-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 122455862 |
| Molecular Formula | C22H20F3N3O3 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 2-[[2-cyclopropyl-6-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrimidin-4-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1cc(OCCC2(C(F)(F)F)CC2)nc(C2CC2)n1 |
| InChI | InChI=1S/C22H20F3N3O3/c23-22(24,25)21(7-8-21)9-10-31-17-11-14(26-18(27-17)13-5-6-13)12-28-19(29)15-3-1-2-4-16(15)20(28)30/h1-4,11,13H,5-10,12H2 |
| InChIKey | APEAZISLVJOPLQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|