C23H14ClN5O3S — CID 122458632
4-[5-chloro-3-(3-cyanophenyl)indazol-1-yl]-3-cyano-N-methylsulfonylbenzamide (PubChem CID 122458632) has the molecular formula C23H14ClN5O3S and a molecular weight of 475.92 g/mol. Its IUPAC name is 4-[5-chloro-3-(3-cyanophenyl)indazol-1-yl]-3-cyano-N-methylsulfonylbenzamide.
| Compound Name | 4-[5-chloro-3-(3-cyanophenyl)indazol-1-yl]-3-cyano-N-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 122458632 |
| Molecular Formula | C23H14ClN5O3S |
| Molecular Weight | 475.92 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | 4-[5-chloro-3-(3-cyanophenyl)indazol-1-yl]-3-cyano-N-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)NC(=O)c1ccc(-n2nc(-c3cccc(C#N)c3)c3cc(Cl)ccc32)c(C#N)c1 |
| InChI | InChI=1S/C23H14ClN5O3S/c1-33(31,32)28-23(30)16-5-7-20(17(10-16)13-26)29-21-8-6-18(24)11-19(21)22(27-29)15-4-2-3-14(9-15)12-25/h2-11H,1H3,(H,28,30) |
| InChIKey | SECYMPTUBKLYHN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 128.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.92 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |