C22H14ClFN4O3S — CID 122458802
4-[5-chloro-3-(3-cyanophenyl)indazol-1-yl]-3-fluoro-N-methylsulfonylbenzamide (PubChem CID 122458802) has the molecular formula C22H14ClFN4O3S and a molecular weight of 468.90 g/mol. Its IUPAC name is 4-[5-chloro-3-(3-cyanophenyl)indazol-1-yl]-3-fluoro-N-methylsulfonylbenzamide.
| Compound Name | 4-[5-chloro-3-(3-cyanophenyl)indazol-1-yl]-3-fluoro-N-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 122458802 |
| Molecular Formula | C22H14ClFN4O3S |
| Molecular Weight | 468.90 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | 4-[5-chloro-3-(3-cyanophenyl)indazol-1-yl]-3-fluoro-N-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)NC(=O)c1ccc(-n2nc(-c3cccc(C#N)c3)c3cc(Cl)ccc32)c(F)c1 |
| InChI | InChI=1S/C22H14ClFN4O3S/c1-32(30,31)27-22(29)15-5-7-20(18(24)10-15)28-19-8-6-16(23)11-17(19)21(26-28)14-4-2-3-13(9-14)12-25/h2-11H,1H3,(H,27,29) |
| InChIKey | GBOQQCHPKRWHKI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 104.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.90 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |