C19H14F2N2O — CID 122461130
5-benzyl-2-(3,4-difluorophenyl)-4H-[1,3]oxazolo[4,5-c]pyridine (PubChem CID 122461130) has the molecular formula C19H14F2N2O and a molecular weight of 324.33 g/mol. Its IUPAC name is 5-benzyl-2-(3,4-difluorophenyl)-4H-[1,3]oxazolo[4,5-c]pyridine.
| Compound Name | 5-benzyl-2-(3,4-difluorophenyl)-4H-[1,3]oxazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 122461130 |
| Molecular Formula | C19H14F2N2O |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 5-benzyl-2-(3,4-difluorophenyl)-4H-[1,3]oxazolo[4,5-c]pyridine |
| SMILES | Fc1ccc(-c2nc3c(o2)C=CN(Cc2ccccc2)C3)cc1F |
| InChI | InChI=1S/C19H14F2N2O/c20-15-7-6-14(10-16(15)21)19-22-17-12-23(9-8-18(17)24-19)11-13-4-2-1-3-5-13/h1-10H,11-12H2 |
| InChIKey | FWODMMPTGMIBKC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |