C16H13NO7S — CID 122463877
[2-amino-4-[7-(hydroxymethyl)-4-oxochromen-3-yl]phenyl] hydrogen sulfate (PubChem CID 122463877) has the molecular formula C16H13NO7S and a molecular weight of 363.35 g/mol. Its IUPAC name is [2-amino-4-[7-(hydroxymethyl)-4-oxochromen-3-yl]phenyl] hydrogen sulfate.
| Compound Name | [2-amino-4-[7-(hydroxymethyl)-4-oxochromen-3-yl]phenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 122463877 |
| Molecular Formula | C16H13NO7S |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | [2-amino-4-[7-(hydroxymethyl)-4-oxochromen-3-yl]phenyl] hydrogen sulfate |
| SMILES | Nc1cc(-c2coc3cc(CO)ccc3c2=O)ccc1OS(=O)(=O)O |
| InChI | InChI=1S/C16H13NO7S/c17-13-6-10(2-4-14(13)24-25(20,21)22)12-8-23-15-5-9(7-18)1-3-11(15)16(12)19/h1-6,8,18H,7,17H2,(H,20,21,22) |
| InChIKey | MRONZVHHMKGOAX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 140.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|