C7H10N2O2 — CID 122473587
3-amino-1,5-dimethylpyridine-2,4-dione (PubChem CID 122473587) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is 3-amino-1,5-dimethylpyridine-2,4-dione.
| Compound Name | 3-amino-1,5-dimethylpyridine-2,4-dione |
|---|---|
| PubChem CID | 122473587 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 3-amino-1,5-dimethylpyridine-2,4-dione |
| SMILES | CC1=CN(C)C(=O)C(N)C1=O |
| InChI | InChI=1S/C7H10N2O2/c1-4-3-9(2)7(11)5(8)6(4)10/h3,5H,8H2,1-2H3 |
| InChIKey | ZORXRYNQVKGAKX-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|