C29H32F4O2 — CID 122480098
2-(7-ethoxy-1,8,9,9-tetrafluorofluoren-2-yl)-5-(4-propylcyclohexyl)-3,6-dihydro-2H-pyran (PubChem CID 122480098) has the molecular formula C29H32F4O2 and a molecular weight of 488.57 g/mol. Its IUPAC name is 2-(7-ethoxy-1,8,9,9-tetrafluorofluoren-2-yl)-5-(4-propylcyclohexyl)-3,6-dihydro-2H-pyran.
| Compound Name | 2-(7-ethoxy-1,8,9,9-tetrafluorofluoren-2-yl)-5-(4-propylcyclohexyl)-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 122480098 |
| Molecular Formula | C29H32F4O2 |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | 2-(7-ethoxy-1,8,9,9-tetrafluorofluoren-2-yl)-5-(4-propylcyclohexyl)-3,6-dihydro-2H-pyran |
| SMILES | CCCC1CCC(C2=CCC(c3ccc4c(c3F)C(F)(F)c3c-4ccc(OCC)c3F)OC2)CC1 |
| InChI | InChI=1S/C29H32F4O2/c1-3-5-17-6-8-18(9-7-17)19-10-14-23(35-16-19)22-12-11-20-21-13-15-24(34-4-2)28(31)26(21)29(32,33)25(20)27(22)30/h10-13,15,17-18,23H,3-9,14,16H2,1-2H3 |
| InChIKey | LDPJYNWHTAHOLJ-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|