C23H30F4O3 — CID 122480222
2-[(4-ethoxy-2,3-difluorophenoxy)-difluoromethyl]-5-(4-propylcyclohexyl)-3,6-dihydro-2H-pyran (PubChem CID 122480222) has the molecular formula C23H30F4O3 and a molecular weight of 430.48 g/mol. Its IUPAC name is 2-[(4-ethoxy-2,3-difluorophenoxy)-difluoromethyl]-5-(4-propylcyclohexyl)-3,6-dihydro-2H-pyran.
| Compound Name | 2-[(4-ethoxy-2,3-difluorophenoxy)-difluoromethyl]-5-(4-propylcyclohexyl)-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 122480222 |
| Molecular Formula | C23H30F4O3 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 2-[(4-ethoxy-2,3-difluorophenoxy)-difluoromethyl]-5-(4-propylcyclohexyl)-3,6-dihydro-2H-pyran |
| SMILES | CCCC1CCC(C2=CCC(C(F)(F)Oc3ccc(OCC)c(F)c3F)OC2)CC1 |
| InChI | InChI=1S/C23H30F4O3/c1-3-5-15-6-8-16(9-7-15)17-10-13-20(29-14-17)23(26,27)30-19-12-11-18(28-4-2)21(24)22(19)25/h10-12,15-16,20H,3-9,13-14H2,1-2H3 |
| InChIKey | DQUJWHBBYJKNHD-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|