C17H22N4O7 — CID 122480526
4-O-[(3R,5S)-1-acetyl-5-[3-(1,2,4-triazol-4-yl)propoxycarbonyl]pyrrolidin-3-yl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 122480526) has the molecular formula C17H22N4O7 and a molecular weight of 394.38 g/mol. Its IUPAC name is 4-O-[(3R,5S)-1-acetyl-5-[3-(1,2,4-triazol-4-yl)propoxycarbonyl]pyrrolidin-3-yl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[(3R,5S)-1-acetyl-5-[3-(1,2,4-triazol-4-yl)propoxycarbonyl]pyrrolidin-3-yl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122480526 |
| Molecular Formula | C17H22N4O7 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 4-O-[(3R,5S)-1-acetyl-5-[3-(1,2,4-triazol-4-yl)propoxycarbonyl]pyrrolidin-3-yl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | COC(=O)/C=C/C(=O)O[C@@H]1C[C@@H](C(=O)OCCCn2cnnc2)N(C(C)=O)C1 |
| InChI | InChI=1S/C17H22N4O7/c1-12(22)21-9-13(28-16(24)5-4-15(23)26-2)8-14(21)17(25)27-7-3-6-20-10-18-19-11-20/h4-5,10-11,13-14H,3,6-9H2,1-2H3/b5-4+/t13-,14+/m1/s1 |
| InChIKey | DABKZPUTFMCXSY-WEHDMVHDSA-N |
| XLogP | -0.53 |
| TPSA | 129.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|