C17H26N2O7 — CID 122480529
4-O-[(3R,5S)-5-(2-methoxyethylcarbamoyl)-1-(2-methylpropanoyl)pyrrolidin-3-yl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 122480529) has the molecular formula C17H26N2O7 and a molecular weight of 370.40 g/mol. Its IUPAC name is 4-O-[(3R,5S)-5-(2-methoxyethylcarbamoyl)-1-(2-methylpropanoyl)pyrrolidin-3-yl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[(3R,5S)-5-(2-methoxyethylcarbamoyl)-1-(2-methylpropanoyl)pyrrolidin-3-yl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122480529 |
| Molecular Formula | C17H26N2O7 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 4-O-[(3R,5S)-5-(2-methoxyethylcarbamoyl)-1-(2-methylpropanoyl)pyrrolidin-3-yl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | COCCNC(=O)[C@@H]1C[C@@H](OC(=O)/C=C/C(=O)OC)CN1C(=O)C(C)C |
| InChI | InChI=1S/C17H26N2O7/c1-11(2)17(23)19-10-12(26-15(21)6-5-14(20)25-4)9-13(19)16(22)18-7-8-24-3/h5-6,11-13H,7-10H2,1-4H3,(H,18,22)/b6-5+/t12-,13+/m1/s1 |
| InChIKey | KDDGEOAEQRGLDU-PBJSTTKNSA-N |
| XLogP | -0.35 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|