C18H26N2O9 — CID 145134579
4-O-[(5S)-5-(dimethylcarbamoyl)-1-(2-methylpropanoyloxymethoxycarbonyl)pyrrolidin-3-yl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 145134579) has the molecular formula C18H26N2O9 and a molecular weight of 414.41 g/mol. Its IUPAC name is 4-O-[(5S)-5-(dimethylcarbamoyl)-1-(2-methylpropanoyloxymethoxycarbonyl)pyrrolidin-3-yl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[(5S)-5-(dimethylcarbamoyl)-1-(2-methylpropanoyloxymethoxycarbonyl)pyrrolidin-3-yl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 145134579 |
| Molecular Formula | C18H26N2O9 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 4-O-[(5S)-5-(dimethylcarbamoyl)-1-(2-methylpropanoyloxymethoxycarbonyl)pyrrolidin-3-yl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | COC(=O)/C=C/C(=O)OC1C[C@@H](C(=O)N(C)C)N(C(=O)OCOC(=O)C(C)C)C1 |
| InChI | InChI=1S/C18H26N2O9/c1-11(2)17(24)27-10-28-18(25)20-9-12(8-13(20)16(23)19(3)4)29-15(22)7-6-14(21)26-5/h6-7,11-13H,8-10H2,1-5H3/b7-6+/t12?,13-/m0/s1 |
| InChIKey | IGZPTPBWXGLADI-AEXKQJSZSA-N |
| XLogP | 0.08 |
| TPSA | 128.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|